C23H40O10S — CID 163613597
2-[4,6-bis(butoxycarbonyl)-2-ethyl-2,4-dimethylhept-6-enoyl]oxy-2-hydroxyethanesulfonic acid (PubChem CID 163613597) has the molecular formula C23H40O10S and a molecular weight of 508.63 g/mol. Its IUPAC name is 2-[4,6-bis(butoxycarbonyl)-2-ethyl-2,4-dimethylhept-6-enoyl]oxy-2-hydroxyethanesulfonic acid.
| Compound Name | 2-[4,6-bis(butoxycarbonyl)-2-ethyl-2,4-dimethylhept-6-enoyl]oxy-2-hydroxyethanesulfonic acid |
|---|---|
| PubChem CID | 163613597 |
| Molecular Formula | C23H40O10S |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | 2-[4,6-bis(butoxycarbonyl)-2-ethyl-2,4-dimethylhept-6-enoyl]oxy-2-hydroxyethanesulfonic acid |
| SMILES | C=C(CC(C)(CC(C)(CC)C(=O)OC(O)CS(=O)(=O)O)C(=O)OCCCC)C(=O)OCCCC |
| InChI | InChI=1S/C23H40O10S/c1-7-10-12-31-19(25)17(4)14-23(6,20(26)32-13-11-8-2)16-22(5,9-3)21(27)33-18(24)15-34(28,29)30/h18,24H,4,7-16H2,1-3,5-6H3,(H,28,29,30) |
| InChIKey | DAIOGIGWQNQKDS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|