C40H67O11S- — CID 164705643
2-[1-[4,6-bis(butoxycarbonyl)-2-ethyl-4-methylhept-6-enoxy]-3-(4-nonylphenoxy)propan-2-yl]oxyethyl sulfate (PubChem CID 164705643) has the molecular formula C40H67O11S- and a molecular weight of 756.03 g/mol. Its IUPAC name is 2-[1-[4,6-bis(butoxycarbonyl)-2-ethyl-4-methylhept-6-enoxy]-3-(4-nonylphenoxy)propan-2-yl]oxyethyl sulfate.
| Compound Name | 2-[1-[4,6-bis(butoxycarbonyl)-2-ethyl-4-methylhept-6-enoxy]-3-(4-nonylphenoxy)propan-2-yl]oxyethyl sulfate |
|---|---|
| PubChem CID | 164705643 |
| Molecular Formula | C40H67O11S- |
| Molecular Weight | 756.03 g/mol |
| Exact Mass | 755.44 |
| IUPAC Name | 2-[1-[4,6-bis(butoxycarbonyl)-2-ethyl-4-methylhept-6-enoxy]-3-(4-nonylphenoxy)propan-2-yl]oxyethyl sulfate |
| SMILES | C=C(CC(C)(CC(CC)COCC(COc1ccc(CCCCCCCCC)cc1)OCCOS(=O)(=O)[O-])C(=O)OCCCC)C(=O)OCCCC |
| InChI | InChI=1S/C40H68O11S/c1-7-11-14-15-16-17-18-19-35-20-22-36(23-21-35)50-32-37(47-26-27-51-52(43,44)45)31-46-30-34(10-4)29-40(6,39(42)49-25-13-9-3)28-33(5)38(41)48-24-12-8-2/h20-23,34,37H,5,7-19,24-32H2,1-4,6H3,(H,43,44,45)/p-1 |
| InChIKey | HYDRXWDQUCTQLO-UHFFFAOYSA-M |
| XLogP | 8.29 |
| TPSA | 146.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.03 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|