C21H28N2O4S — CID 138967395
tert-butyl 4-[3-(1,3-dioxoisoindol-2-yl)propyl]-2,2-dimethyl-1,3-thiazolidine-3-carboxylate (PubChem CID 138967395) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is tert-butyl 4-[3-(1,3-dioxoisoindol-2-yl)propyl]-2,2-dimethyl-1,3-thiazolidine-3-carboxylate.
| Compound Name | tert-butyl 4-[3-(1,3-dioxoisoindol-2-yl)propyl]-2,2-dimethyl-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 138967395 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | tert-butyl 4-[3-(1,3-dioxoisoindol-2-yl)propyl]-2,2-dimethyl-1,3-thiazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(CCCN2C(=O)c3ccccc3C2=O)CSC1(C)C |
| InChI | InChI=1S/C21H28N2O4S/c1-20(2,3)27-19(26)23-14(13-28-21(23,4)5)9-8-12-22-17(24)15-10-6-7-11-16(15)18(22)25/h6-7,10-11,14H,8-9,12-13H2,1-5H3 |
| InChIKey | KTWRKGHSZITZNT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|