C12H16O4S — CID 138968548
(4S)-4-[2-(benzenesulfonyl)ethyl]-1,3-dioxane (PubChem CID 138968548) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is (4S)-4-[2-(benzenesulfonyl)ethyl]-1,3-dioxane.
| Compound Name | (4S)-4-[2-(benzenesulfonyl)ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 138968548 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (4S)-4-[2-(benzenesulfonyl)ethyl]-1,3-dioxane |
| SMILES | O=S(=O)(CC[C@@H]1CCOCO1)c1ccccc1 |
| InChI | InChI=1S/C12H16O4S/c13-17(14,12-4-2-1-3-5-12)9-7-11-6-8-15-10-16-11/h1-5,11H,6-10H2/t11-/m0/s1 |
| InChIKey | XKVNSXIPUUTDRM-NSHDSACASA-N |
| XLogP | 1.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |