C26H32NOPSi — CID 138968825
diphenyl-[(5E)-5-[(4S)-4-propan-2-yl-1,3-oxazolidin-2-ylidene]-4-trimethylsilylcyclopenta-1,3-dien-1-yl]phosphane (PubChem CID 138968825) has the molecular formula C26H32NOPSi and a molecular weight of 433.61 g/mol. Its IUPAC name is diphenyl-[(5E)-5-[(4S)-4-propan-2-yl-1,3-oxazolidin-2-ylidene]-4-trimethylsilylcyclopenta-1,3-dien-1-yl]phosphane.
| Compound Name | diphenyl-[(5E)-5-[(4S)-4-propan-2-yl-1,3-oxazolidin-2-ylidene]-4-trimethylsilylcyclopenta-1,3-dien-1-yl]phosphane |
|---|---|
| PubChem CID | 138968825 |
| Molecular Formula | C26H32NOPSi |
| Molecular Weight | 433.61 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | diphenyl-[(5E)-5-[(4S)-4-propan-2-yl-1,3-oxazolidin-2-ylidene]-4-trimethylsilylcyclopenta-1,3-dien-1-yl]phosphane |
| SMILES | CC(C)[C@H]1CO/C(=C2/C(P(c3ccccc3)c3ccccc3)=CC=C2[Si](C)(C)C)N1 |
| InChI | InChI=1S/C26H32NOPSi/c1-19(2)22-18-28-26(27-22)25-23(16-17-24(25)30(3,4)5)29(20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-17,19,22,27H,18H2,1-5H3/b26-25-/t22-/m1/s1 |
| InChIKey | SUEWHEROWYKYNK-FPEJUQHSSA-N |
| XLogP | 5.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|