C23H23NOP- — CID 11985404
diphenyl-[5-(4-propan-2-yl-1,3-oxazolidin-3-id-2-ylidene)cyclopenta-1,3-dien-1-yl]phosphane (PubChem CID 11985404) has the molecular formula C23H23NOP- and a molecular weight of 360.42 g/mol. Its IUPAC name is diphenyl-[5-(4-propan-2-yl-1,3-oxazolidin-3-id-2-ylidene)cyclopenta-1,3-dien-1-yl]phosphane.
| Compound Name | diphenyl-[5-(4-propan-2-yl-1,3-oxazolidin-3-id-2-ylidene)cyclopenta-1,3-dien-1-yl]phosphane |
|---|---|
| PubChem CID | 11985404 |
| Molecular Formula | C23H23NOP- |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | diphenyl-[5-(4-propan-2-yl-1,3-oxazolidin-3-id-2-ylidene)cyclopenta-1,3-dien-1-yl]phosphane |
| SMILES | CC(C)C1COC(=C2C=CC=C2P(c2ccccc2)c2ccccc2)[N-]1 |
| InChI | InChI=1S/C23H23NOP/c1-17(2)21-16-25-23(24-21)20-14-9-15-22(20)26(18-10-5-3-6-11-18)19-12-7-4-8-13-19/h3-15,17,21H,16H2,1-2H3/q-1 |
| InChIKey | BLPQOTCDEPEFBT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 23.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|