About CID 11136491
CID 11136491 (PubChem CID 11136491) has the molecular formula C46H46FeN2O2P2+2
and a molecular weight of 776.68 g/mol.
Molecular Properties
| Compound Name | CID 11136491 |
| PubChem CID | 11136491 |
| Molecular Formula | C46H46FeN2O2P2+2 |
| Molecular Weight | 776.68 g/mol |
| Exact Mass | 776.24 |
| IUPAC Name | — |
| SMILES | CC(C)[C@H]1COC([C]2[CH][CH][CH][C]2P(c2ccccc2)c2ccccc2)=N1.CC(C)[C@H]1COC([C]2[CH][CH][CH][C]2P(c2ccccc2)c2ccccc2)=N1.[Fe+2] |
| InChI | InChI=1S/2C23H23NOP.Fe/c2*1-17(2)21-16-25-23(24-21)20-14-9-15-22(20)26(18-10-5-3-6-11-18)19-12-7-4-8-13-19;/h2*3-15,17,21H,16H2,1-2H3;/q;;+2/t2*21-;/m11./s1 |
| InChIKey | GUFBBGAPITWHJI-ITEXDBGESA-N |
| XLogP | 8.61 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 776.68 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 11136491 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11136491?
The IUPAC name of CID 11136491 (CID 11136491) is not available.
What is the SMILES notation for CID 11136491?
The canonical SMILES for CID 11136491 is CC(C)[C@H]1COC([C]2[CH][CH][CH][C]2P(c2ccccc2)c2ccccc2)=N1.CC(C)[C@H]1COC([C]2[CH][CH][CH][C]2P(c2ccccc2)c2ccccc2)=N1.[Fe+2].
What is the InChIKey of CID 11136491?
The InChIKey is GUFBBGAPITWHJI-ITEXDBGESA-N. The full InChI is InChI=1S/2C23H23NOP.Fe/c2*1-17(2)21-16-25-23(24-21)20-14-9-15-22(20)26(18-10-5-3-6-11-18)19-12-7-4-8-13-19;/h2*3-15,17,21H,16H2,1-2H3;/q;;+2/t2*21-;/m11./s1.
What are the key properties of CID 11136491?
CID 11136491 has a molecular weight of 776.68 g/mol, XLogP of 8.61, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11136491 is sourced from PubChem (CID 11136491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).