C29H29N2O2PS — CID 138969223
N-pent-4-enyl-2-[(triphenyl-λ5-phosphanylidene)amino]benzenesulfonamide (PubChem CID 138969223) has the molecular formula C29H29N2O2PS and a molecular weight of 500.60 g/mol. Its IUPAC name is N-pent-4-enyl-2-[(triphenyl-λ5-phosphanylidene)amino]benzenesulfonamide.
| Compound Name | N-pent-4-enyl-2-[(triphenyl-λ5-phosphanylidene)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 138969223 |
| Molecular Formula | C29H29N2O2PS |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | N-pent-4-enyl-2-[(triphenyl-λ5-phosphanylidene)amino]benzenesulfonamide |
| SMILES | C=CCCCNS(=O)(=O)c1ccccc1N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H29N2O2PS/c1-2-3-15-24-30-35(32,33)29-23-14-13-22-28(29)31-34(25-16-7-4-8-17-25,26-18-9-5-10-19-26)27-20-11-6-12-21-27/h2,4-14,16-23,30H,1,3,15,24H2 |
| InChIKey | JJNSYWKAMPSHCC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|