C15H14O2Se — CID 138969665
1-phenylselanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one (PubChem CID 138969665) has the molecular formula C15H14O2Se and a molecular weight of 305.23 g/mol. Its IUPAC name is 1-phenylselanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one.
| Compound Name | 1-phenylselanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one |
|---|---|
| PubChem CID | 138969665 |
| Molecular Formula | C15H14O2Se |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 1-phenylselanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one |
| SMILES | O=C1C2CCC1C1([Se]c3ccccc3)C=CC2O1 |
| InChI | InChI=1S/C15H14O2Se/c16-14-11-6-7-12(14)15(9-8-13(11)17-15)18-10-4-2-1-3-5-10/h1-5,8-9,11-13H,6-7H2 |
| InChIKey | KYRBBKLHVXDMFB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|