C17H18O2 — CID 139040041
(1S,2S,3R,5R,6R)-2,5-dimethyl-3-phenyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one (PubChem CID 139040041) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is (1S,2S,3R,5R,6R)-2,5-dimethyl-3-phenyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one.
| Compound Name | (1S,2S,3R,5R,6R)-2,5-dimethyl-3-phenyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one |
|---|---|
| PubChem CID | 139040041 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (1S,2S,3R,5R,6R)-2,5-dimethyl-3-phenyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one |
| SMILES | C[C@]12C(=O)[C@](C)(C[C@@H]1c1ccccc1)[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C17H18O2/c1-16-10-12(11-6-4-3-5-7-11)17(2,15(16)18)14-9-8-13(16)19-14/h3-9,12-14H,10H2,1-2H3/t12-,13-,14+,16-,17+/m1/s1 |
| InChIKey | RZRPPVPVNVOXPO-WDTWZTHCSA-N |
| XLogP | 3.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|