C19H26O2 — CID 134907450
1-[(1R,2S,3aR,6aS)-5,5-dimethyl-1-phenylmethoxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]ethanone (PubChem CID 134907450) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-[(1R,2S,3aR,6aS)-5,5-dimethyl-1-phenylmethoxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]ethanone.
| Compound Name | 1-[(1R,2S,3aR,6aS)-5,5-dimethyl-1-phenylmethoxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]ethanone |
|---|---|
| PubChem CID | 134907450 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 1-[(1R,2S,3aR,6aS)-5,5-dimethyl-1-phenylmethoxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]ethanone |
| SMILES | CC(=O)[C@H]1C[C@@H]2CC(C)(C)C[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H26O2/c1-13(20)16-9-15-10-19(2,3)11-17(15)18(16)21-12-14-7-5-4-6-8-14/h4-8,15-18H,9-12H2,1-3H3/t15-,16-,17+,18+/m1/s1 |
| InChIKey | JBEZFMDWPBXUNC-BDXSIMOUSA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |