C23H22O2 — CID 139123721
(1R,2R,3S,4S,5S,6S)-2,5-dimethyl-3,4-diphenyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one (PubChem CID 139123721) has the molecular formula C23H22O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (1R,2R,3S,4S,5S,6S)-2,5-dimethyl-3,4-diphenyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one.
| Compound Name | (1R,2R,3S,4S,5S,6S)-2,5-dimethyl-3,4-diphenyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one |
|---|---|
| PubChem CID | 139123721 |
| Molecular Formula | C23H22O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (1R,2R,3S,4S,5S,6S)-2,5-dimethyl-3,4-diphenyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one |
| SMILES | C[C@]12C(=O)[C@](C)([C@H](c3ccccc3)[C@H]1c1ccccc1)[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C23H22O2/c1-22-17-13-14-18(25-17)23(2,21(22)24)20(16-11-7-4-8-12-16)19(22)15-9-5-3-6-10-15/h3-14,17-20H,1-2H3/t17-,18+,19-,20-,22+,23-/m1/s1 |
| InChIKey | ZFIMFCJAXXIOJS-XWOVPUAZSA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|