C38H35NO8 — CID 138970222
1-O,2-O-dibenzyl 8-O-methyl (1R,2S,3R,8S)-5-oxo-3-(4-phenylmethoxyphenyl)-2,3,6,7-tetrahydro-1H-pyrrolizine-1,2,8-tricarboxylate (PubChem CID 138970222) has the molecular formula C38H35NO8 and a molecular weight of 633.70 g/mol. Its IUPAC name is 1-O,2-O-dibenzyl 8-O-methyl (1R,2S,3R,8S)-5-oxo-3-(4-phenylmethoxyphenyl)-2,3,6,7-tetrahydro-1H-pyrrolizine-1,2,8-tricarboxylate.
| Compound Name | 1-O,2-O-dibenzyl 8-O-methyl (1R,2S,3R,8S)-5-oxo-3-(4-phenylmethoxyphenyl)-2,3,6,7-tetrahydro-1H-pyrrolizine-1,2,8-tricarboxylate |
|---|---|
| PubChem CID | 138970222 |
| Molecular Formula | C38H35NO8 |
| Molecular Weight | 633.70 g/mol |
| Exact Mass | 633.24 |
| IUPAC Name | 1-O,2-O-dibenzyl 8-O-methyl (1R,2S,3R,8S)-5-oxo-3-(4-phenylmethoxyphenyl)-2,3,6,7-tetrahydro-1H-pyrrolizine-1,2,8-tricarboxylate |
| SMILES | COC(=O)[C@@]12CCC(=O)N1[C@@H](c1ccc(OCc3ccccc3)cc1)[C@@H](C(=O)OCc1ccccc1)[C@H]2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H35NO8/c1-44-37(43)38-22-21-31(40)39(38)34(29-17-19-30(20-18-29)45-23-26-11-5-2-6-12-26)32(35(41)46-24-27-13-7-3-8-14-27)33(38)36(42)47-25-28-15-9-4-10-16-28/h2-20,32-34H,21-25H2,1H3/t32-,33-,34-,38-/m0/s1 |
| InChIKey | CNMVRLWXHADGFT-QFOROZRWSA-N |
| XLogP | 5.57 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.70 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|