C29H26N3OPS — CID 138970988
1-(1,3-benzothiazol-2-yl)-3-[(2S)-1-diphenylphosphanyl-3-phenylpropan-2-yl]urea (PubChem CID 138970988) has the molecular formula C29H26N3OPS and a molecular weight of 495.59 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-[(2S)-1-diphenylphosphanyl-3-phenylpropan-2-yl]urea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-[(2S)-1-diphenylphosphanyl-3-phenylpropan-2-yl]urea |
|---|---|
| PubChem CID | 138970988 |
| Molecular Formula | C29H26N3OPS |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-[(2S)-1-diphenylphosphanyl-3-phenylpropan-2-yl]urea |
| SMILES | O=C(Nc1nc2ccccc2s1)N[C@@H](Cc1ccccc1)CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H26N3OPS/c33-28(32-29-31-26-18-10-11-19-27(26)35-29)30-23(20-22-12-4-1-5-13-22)21-34(24-14-6-2-7-15-24)25-16-8-3-9-17-25/h1-19,23H,20-21H2,(H2,30,31,32,33)/t23-/m0/s1 |
| InChIKey | YBUPMZBDMUUBQN-QHCPKHFHSA-N |
| XLogP | 6.16 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|