C19H24O5 — CID 138972032
(1S,2R,7S,9R,12S,15S)-2,15-dihydroxy-10,10-dimethoxypentacyclo[7.5.3.01,6.07,12.012,16]heptadeca-5,16-dien-11-one (PubChem CID 138972032) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is (1S,2R,7S,9R,12S,15S)-2,15-dihydroxy-10,10-dimethoxypentacyclo[7.5.3.01,6.07,12.012,16]heptadeca-5,16-dien-11-one.
| Compound Name | (1S,2R,7S,9R,12S,15S)-2,15-dihydroxy-10,10-dimethoxypentacyclo[7.5.3.01,6.07,12.012,16]heptadeca-5,16-dien-11-one |
|---|---|
| PubChem CID | 138972032 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (1S,2R,7S,9R,12S,15S)-2,15-dihydroxy-10,10-dimethoxypentacyclo[7.5.3.01,6.07,12.012,16]heptadeca-5,16-dien-11-one |
| SMILES | COC1(OC)C(=O)[C@@]23CC[C@]45C(=CCC[C@H]4O)[C@@H]2C[C@@H]1C=C3[C@@H]5O |
| InChI | InChI=1S/C19H24O5/c1-23-19(24-2)10-8-12-11-4-3-5-14(20)18(11)7-6-17(12,16(19)22)13(9-10)15(18)21/h4,9-10,12,14-15,20-21H,3,5-8H2,1-2H3/t10-,12+,14-,15+,17+,18+/m1/s1 |
| InChIKey | XQSRIHPRNHIRFB-LFCBWKOASA-N |
| XLogP | 1.34 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|