C30H30N4O6 — CID 138973207
23,26-dipyridin-2-yl-5,8,11,14,17,28-hexaoxa-24,25-diazapentacyclo[19.6.1.02,20.04,18.022,27]octacosa-2,4(18),19,23,25-pentaene (PubChem CID 138973207) has the molecular formula C30H30N4O6 and a molecular weight of 542.59 g/mol. Its IUPAC name is 23,26-dipyridin-2-yl-5,8,11,14,17,28-hexaoxa-24,25-diazapentacyclo[19.6.1.02,20.04,18.022,27]octacosa-2,4(18),19,23,25-pentaene.
| Compound Name | 23,26-dipyridin-2-yl-5,8,11,14,17,28-hexaoxa-24,25-diazapentacyclo[19.6.1.02,20.04,18.022,27]octacosa-2,4(18),19,23,25-pentaene |
|---|---|
| PubChem CID | 138973207 |
| Molecular Formula | C30H30N4O6 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 23,26-dipyridin-2-yl-5,8,11,14,17,28-hexaoxa-24,25-diazapentacyclo[19.6.1.02,20.04,18.022,27]octacosa-2,4(18),19,23,25-pentaene |
| SMILES | c1ccc(C2=NN=C(c3ccccn3)C3C4OC(c5cc6c(cc54)OCCOCCOCCOCCO6)C23)nc1 |
| InChI | InChI=1S/C30H30N4O6/c1-3-7-31-21(5-1)27-25-26(28(34-33-27)22-6-2-4-8-32-22)30-20-18-24-23(17-19(20)29(25)40-30)38-15-13-36-11-9-35-10-12-37-14-16-39-24/h1-8,17-18,25-26,29-30H,9-16H2 |
| InChIKey | YOUPZCZYNRBKQX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 105.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |