C21H15ClO4 — CID 138978417
methyl (2S,3R)-3-chloro-6-oxo-4-phenyl-2-(2-phenylethynyl)-3H-pyran-2-carboxylate (PubChem CID 138978417) has the molecular formula C21H15ClO4 and a molecular weight of 366.80 g/mol. Its IUPAC name is methyl (2S,3R)-3-chloro-6-oxo-4-phenyl-2-(2-phenylethynyl)-3H-pyran-2-carboxylate.
| Compound Name | methyl (2S,3R)-3-chloro-6-oxo-4-phenyl-2-(2-phenylethynyl)-3H-pyran-2-carboxylate |
|---|---|
| PubChem CID | 138978417 |
| Molecular Formula | C21H15ClO4 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | methyl (2S,3R)-3-chloro-6-oxo-4-phenyl-2-(2-phenylethynyl)-3H-pyran-2-carboxylate |
| SMILES | COC(=O)[C@]1(C#Cc2ccccc2)OC(=O)C=C(c2ccccc2)[C@H]1Cl |
| InChI | InChI=1S/C21H15ClO4/c1-25-20(24)21(13-12-15-8-4-2-5-9-15)19(22)17(14-18(23)26-21)16-10-6-3-7-11-16/h2-11,14,19H,1H3/t19-,21-/m1/s1 |
| InChIKey | XSXRKMHROMZBMG-TZIWHRDSSA-N |
| XLogP | 3.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|