C22H23N3O3 — CID 138978713
tert-butyl N-[2-[(12aS)-12-oxoindolo[1,2-c]quinazolin-12a-yl]ethyl]carbamate (PubChem CID 138978713) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is tert-butyl N-[2-[(12aS)-12-oxoindolo[1,2-c]quinazolin-12a-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(12aS)-12-oxoindolo[1,2-c]quinazolin-12a-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 138978713 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | tert-butyl N-[2-[(12aS)-12-oxoindolo[1,2-c]quinazolin-12a-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC[C@]12C(=O)c3ccccc3N1C=Nc1ccccc12 |
| InChI | InChI=1S/C22H23N3O3/c1-21(2,3)28-20(27)23-13-12-22-16-9-5-6-10-17(16)24-14-25(22)18-11-7-4-8-15(18)19(22)26/h4-11,14H,12-13H2,1-3H3,(H,23,27)/t22-/m0/s1 |
| InChIKey | PHFHYVAFTXIPKE-QFIPXVFZSA-N |
| XLogP | 4.17 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |