C6H10ClF3O3S — CID 138980152
1,1,1-trifluoro-6-hydroxyhexane-3-sulfonyl chloride (PubChem CID 138980152) has the molecular formula C6H10ClF3O3S and a molecular weight of 254.66 g/mol. Its IUPAC name is 1,1,1-trifluoro-6-hydroxyhexane-3-sulfonyl chloride.
| Compound Name | 1,1,1-trifluoro-6-hydroxyhexane-3-sulfonyl chloride |
|---|---|
| PubChem CID | 138980152 |
| Molecular Formula | C6H10ClF3O3S |
| Molecular Weight | 254.66 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | 1,1,1-trifluoro-6-hydroxyhexane-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)C(CCCO)CC(F)(F)F |
| InChI | InChI=1S/C6H10ClF3O3S/c7-14(12,13)5(2-1-3-11)4-6(8,9)10/h5,11H,1-4H2 |
| InChIKey | HBVMWJYLNFZDGB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.66 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |