C10H8F3N3O — CID 138980318
azido-[2-(3,3,3-trifluoropropyl)phenyl]methanolate (PubChem CID 138980318) has the molecular formula C10H8F3N3O and a molecular weight of 243.19 g/mol. Its IUPAC name is azido-[2-(3,3,3-trifluoropropyl)phenyl]methanolate.
| Compound Name | azido-[2-(3,3,3-trifluoropropyl)phenyl]methanolate |
|---|---|
| PubChem CID | 138980318 |
| Molecular Formula | C10H8F3N3O |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | azido-[2-(3,3,3-trifluoropropyl)phenyl]methanolate |
| SMILES | [N-]=[N+]=NC([O-])c1ccccc1[CH+]CC(F)(F)F |
| InChI | InChI=1S/C10H8F3N3O/c11-10(12,13)6-5-7-3-1-2-4-8(7)9(17)15-16-14/h1-5,9H,6H2 |
| InChIKey | KEZRQGAAXWIAMS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 71.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|