C11H9F6N3O — CID 86643564
1-(azidomethyl)-4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)benzene (PubChem CID 86643564) has the molecular formula C11H9F6N3O and a molecular weight of 313.20 g/mol. Its IUPAC name is 1-(azidomethyl)-4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)benzene.
| Compound Name | 1-(azidomethyl)-4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)benzene |
|---|---|
| PubChem CID | 86643564 |
| Molecular Formula | C11H9F6N3O |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 1-(azidomethyl)-4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)benzene |
| SMILES | COC(c1ccc(CN=[N+]=[N-])cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H9F6N3O/c1-21-9(10(12,13)14,11(15,16)17)8-4-2-7(3-5-8)6-19-20-18/h2-5H,6H2,1H3 |
| InChIKey | XNUKJAKPBMPCDF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|