C11H10F3N3O — CID 138980552
(1S,3S)-3-azido-5-methyl-1-(2,2,2-trifluoroethyl)-1,3-dihydro-2-benzofuran (PubChem CID 138980552) has the molecular formula C11H10F3N3O and a molecular weight of 257.21 g/mol. Its IUPAC name is (1S,3S)-3-azido-5-methyl-1-(2,2,2-trifluoroethyl)-1,3-dihydro-2-benzofuran.
| Compound Name | (1S,3S)-3-azido-5-methyl-1-(2,2,2-trifluoroethyl)-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 138980552 |
| Molecular Formula | C11H10F3N3O |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | (1S,3S)-3-azido-5-methyl-1-(2,2,2-trifluoroethyl)-1,3-dihydro-2-benzofuran |
| SMILES | Cc1ccc2c(c1)[C@@H](N=[N+]=[N-])O[C@H]2CC(F)(F)F |
| InChI | InChI=1S/C11H10F3N3O/c1-6-2-3-7-8(4-6)10(16-17-15)18-9(7)5-11(12,13)14/h2-4,9-10H,5H2,1H3/t9-,10-/m0/s1 |
| InChIKey | LDTDMCMLHDOCMS-UWVGGRQHSA-N |
| XLogP | 4.33 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|