C24H25ClN2O3 — CID 138980743
tert-butyl N-[(1R,2R)-1-(4-chlorophenyl)-2-(1-oxidopyridin-1-ium-2-yl)-2-phenylethyl]carbamate (PubChem CID 138980743) has the molecular formula C24H25ClN2O3 and a molecular weight of 424.93 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-1-(4-chlorophenyl)-2-(1-oxidopyridin-1-ium-2-yl)-2-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-1-(4-chlorophenyl)-2-(1-oxidopyridin-1-ium-2-yl)-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 138980743 |
| Molecular Formula | C24H25ClN2O3 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | tert-butyl N-[(1R,2R)-1-(4-chlorophenyl)-2-(1-oxidopyridin-1-ium-2-yl)-2-phenylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](c1ccc(Cl)cc1)[C@@H](c1ccccc1)c1cccc[n+]1[O-] |
| InChI | InChI=1S/C24H25ClN2O3/c1-24(2,3)30-23(28)26-22(18-12-14-19(25)15-13-18)21(17-9-5-4-6-10-17)20-11-7-8-16-27(20)29/h4-16,21-22H,1-3H3,(H,26,28)/t21-,22-/m0/s1 |
| InChIKey | BSBSDBZCMJIQES-VXKWHMMOSA-N |
| XLogP | 5.37 |
| TPSA | 65.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|