C21H19NO3 — CID 138982450
(1R,10R)-11,11-dimethyl-16-phenyl-8,12,14-trioxa-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17),15-pentaene (PubChem CID 138982450) has the molecular formula C21H19NO3 and a molecular weight of 333.39 g/mol. Its IUPAC name is (1R,10R)-11,11-dimethyl-16-phenyl-8,12,14-trioxa-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17),15-pentaene.
| Compound Name | (1R,10R)-11,11-dimethyl-16-phenyl-8,12,14-trioxa-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17),15-pentaene |
|---|---|
| PubChem CID | 138982450 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (1R,10R)-11,11-dimethyl-16-phenyl-8,12,14-trioxa-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17),15-pentaene |
| SMILES | CC1(C)Oc2onc(-c3ccccc3)c2[C@H]2c3ccccc3OC[C@@H]21 |
| InChI | InChI=1S/C21H19NO3/c1-21(2)15-12-23-16-11-7-6-10-14(16)17(15)18-19(22-25-20(18)24-21)13-8-4-3-5-9-13/h3-11,15,17H,12H2,1-2H3/t15-,17-/m0/s1 |
| InChIKey | ZGWWRHBICZIJOA-RDJZCZTQSA-N |
| XLogP | 4.65 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |