C22H21NO3 — CID 85233289
1-(12,12-dimethyl-11,15-dioxa-3-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4,6,8,16,18,20-heptaen-3-yl)ethanone (PubChem CID 85233289) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is 1-(12,12-dimethyl-11,15-dioxa-3-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4,6,8,16,18,20-heptaen-3-yl)ethanone.
| Compound Name | 1-(12,12-dimethyl-11,15-dioxa-3-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4,6,8,16,18,20-heptaen-3-yl)ethanone |
|---|---|
| PubChem CID | 85233289 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 1-(12,12-dimethyl-11,15-dioxa-3-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4,6,8,16,18,20-heptaen-3-yl)ethanone |
| SMILES | CC(=O)n1c2c(c3ccccc31)OC(C)(C)C1COc3ccccc3C21 |
| InChI | InChI=1S/C22H21NO3/c1-13(24)23-17-10-6-4-8-14(17)21-20(23)19-15-9-5-7-11-18(15)25-12-16(19)22(2,3)26-21/h4-11,16,19H,12H2,1-3H3 |
| InChIKey | LRIVPAJLUQADOX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |