C22H38O3Si — CID 138982783
[(1R,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethynyl-2-methyl-2-(4-methylpent-3-enyl)cyclopentyl] acetate (PubChem CID 138982783) has the molecular formula C22H38O3Si and a molecular weight of 378.63 g/mol. Its IUPAC name is [(1R,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethynyl-2-methyl-2-(4-methylpent-3-enyl)cyclopentyl] acetate.
| Compound Name | [(1R,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethynyl-2-methyl-2-(4-methylpent-3-enyl)cyclopentyl] acetate |
|---|---|
| PubChem CID | 138982783 |
| Molecular Formula | C22H38O3Si |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | [(1R,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethynyl-2-methyl-2-(4-methylpent-3-enyl)cyclopentyl] acetate |
| SMILES | C#C[C@]1(OC(C)=O)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)CCC=C(C)C |
| InChI | InChI=1S/C22H38O3Si/c1-11-22(24-18(4)23)16-14-19(25-26(9,10)20(5,6)7)21(22,8)15-12-13-17(2)3/h1,13,19H,12,14-16H2,2-10H3/t19-,21+,22-/m0/s1 |
| InChIKey | VJOWQBUTUVXQRA-NNWRFLSQSA-N |
| XLogP | 5.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|