C52H54N2O10 — CID 138983863
benzyl N-[(1R)-2-hydroxy-1-[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]-N-(phenylmethoxycarbonylamino)carbamate (PubChem CID 138983863) has the molecular formula C52H54N2O10 and a molecular weight of 867.01 g/mol. Its IUPAC name is benzyl N-[(1R)-2-hydroxy-1-[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]-N-(phenylmethoxycarbonylamino)carbamate.
| Compound Name | benzyl N-[(1R)-2-hydroxy-1-[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]-N-(phenylmethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 138983863 |
| Molecular Formula | C52H54N2O10 |
| Molecular Weight | 867.01 g/mol |
| Exact Mass | 866.38 |
| IUPAC Name | benzyl N-[(1R)-2-hydroxy-1-[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]-N-(phenylmethoxycarbonylamino)carbamate |
| SMILES | O=C(NN(C(=O)OCc1ccccc1)[C@H](CO)[C@@H]1OC(COCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C52H54N2O10/c55-31-45(54(52(57)63-37-44-29-17-6-18-30-44)53-51(56)62-36-43-27-15-5-16-28-43)47-49(60-34-41-23-11-3-12-24-41)50(61-35-42-25-13-4-14-26-42)48(59-33-40-21-9-2-10-22-40)46(64-47)38-58-32-39-19-7-1-8-20-39/h1-30,45-50,55H,31-38H2,(H,53,56)/t45-,46?,47+,48-,49?,50?/m1/s1 |
| InChIKey | YMNWALRYTFBIMF-SURPPXJZSA-N |
| XLogP | 8.57 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.01 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|