C7H12ClNO3 — CID 138991560
(3S,3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole-3-carboxylic acid;hydrochloride (PubChem CID 138991560) has the molecular formula C7H12ClNO3 and a molecular weight of 193.63 g/mol. Its IUPAC name is (3S,3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole-3-carboxylic acid;hydrochloride.
| Compound Name | (3S,3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 138991560 |
| Molecular Formula | C7H12ClNO3 |
| Molecular Weight | 193.63 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | (3S,3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@@H]1CO[C@@H]2CNC[C@@H]21 |
| InChI | InChI=1S/C7H11NO3.ClH/c9-7(10)5-3-11-6-2-8-1-4(5)6;/h4-6,8H,1-3H2,(H,9,10);1H/t4-,5-,6-;/m1./s1 |
| InChIKey | FQDWJFTVWTZUOK-RWOHWRPJSA-N |
| XLogP | -0.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.63 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |