C19H21ClN2O4 — CID 138992210
2-(3-chlorophenyl)-1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-hydroxybutan-1-one (PubChem CID 138992210) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-hydroxybutan-1-one.
| Compound Name | 2-(3-chlorophenyl)-1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-hydroxybutan-1-one |
|---|---|
| PubChem CID | 138992210 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-(3-chlorophenyl)-1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-hydroxybutan-1-one |
| SMILES | CCC(O)(C(=O)N1CCN(C(=O)c2ccco2)CC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H21ClN2O4/c1-2-19(25,14-5-3-6-15(20)13-14)18(24)22-10-8-21(9-11-22)17(23)16-7-4-12-26-16/h3-7,12-13,25H,2,8-11H2,1H3 |
| InChIKey | IAHJCJAUMXURRS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |