C16H33AsClNSi2 — CID 139036734
5-[[bis(trimethylsilyl)amino]-chloroarsanyl]-1,2,3,4,5-pentamethylcyclopenta-1,3-diene (PubChem CID 139036734) has the molecular formula C16H33AsClNSi2 and a molecular weight of 405.99 g/mol. Its IUPAC name is 5-[[bis(trimethylsilyl)amino]-chloroarsanyl]-1,2,3,4,5-pentamethylcyclopenta-1,3-diene.
| Compound Name | 5-[[bis(trimethylsilyl)amino]-chloroarsanyl]-1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 139036734 |
| Molecular Formula | C16H33AsClNSi2 |
| Molecular Weight | 405.99 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 5-[[bis(trimethylsilyl)amino]-chloroarsanyl]-1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
| SMILES | CC1=C(C)C(C)([As@](Cl)N([Si](C)(C)C)[Si](C)(C)C)C(C)=C1C |
| InChI | InChI=1S/C16H33AsClNSi2/c1-12-13(2)15(4)16(5,14(12)3)17(18)19(20(6,7)8)21(9,10)11/h1-11H3/t17-/m1/s1 |
| InChIKey | RLLWBKVAJCFQPZ-QGZVFWFLSA-N |
| XLogP | 6.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.99 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|