C22H28O2 — CID 139037303
(6aR,11aS,11bR)-7-methoxy-4,6a,8,11b-tetramethyl-1,2,5,6,11,11a-hexahydrobenzo[a]fluoren-3-one (PubChem CID 139037303) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is (6aR,11aS,11bR)-7-methoxy-4,6a,8,11b-tetramethyl-1,2,5,6,11,11a-hexahydrobenzo[a]fluoren-3-one.
| Compound Name | (6aR,11aS,11bR)-7-methoxy-4,6a,8,11b-tetramethyl-1,2,5,6,11,11a-hexahydrobenzo[a]fluoren-3-one |
|---|---|
| PubChem CID | 139037303 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | (6aR,11aS,11bR)-7-methoxy-4,6a,8,11b-tetramethyl-1,2,5,6,11,11a-hexahydrobenzo[a]fluoren-3-one |
| SMILES | COc1c(C)ccc2c1[C@]1(C)CCC3=C(C)C(=O)CC[C@]3(C)[C@@H]1C2 |
| InChI | InChI=1S/C22H28O2/c1-13-6-7-15-12-18-21(3)11-9-17(23)14(2)16(21)8-10-22(18,4)19(15)20(13)24-5/h6-7,18H,8-12H2,1-5H3/t18-,21-,22+/m0/s1 |
| InChIKey | PXDOSLPRCIOHQX-YUXAGFNASA-N |
| XLogP | 4.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |