C28H36O6 — CID 139038251
5',6',14',15'-tetramethoxy-5,5-dimethylspiro[1,3-dioxane-2,19'-tetracyclo[8.8.1.03,8.012,17]nonadeca-3,5,7,12,14,16-hexaene] (PubChem CID 139038251) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is 5',6',14',15'-tetramethoxy-5,5-dimethylspiro[1,3-dioxane-2,19'-tetracyclo[8.8.1.03,8.012,17]nonadeca-3,5,7,12,14,16-hexaene].
| Compound Name | 5',6',14',15'-tetramethoxy-5,5-dimethylspiro[1,3-dioxane-2,19'-tetracyclo[8.8.1.03,8.012,17]nonadeca-3,5,7,12,14,16-hexaene] |
|---|---|
| PubChem CID | 139038251 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 5',6',14',15'-tetramethoxy-5,5-dimethylspiro[1,3-dioxane-2,19'-tetracyclo[8.8.1.03,8.012,17]nonadeca-3,5,7,12,14,16-hexaene] |
| SMILES | COc1cc2c(cc1OC)CC1Cc3cc(OC)c(OC)cc3CC(C2)C12OCC(C)(C)CO2 |
| InChI | InChI=1S/C28H36O6/c1-27(2)15-33-28(34-16-27)21-7-17-11-23(29-3)24(30-4)12-18(17)8-22(28)10-20-14-26(32-6)25(31-5)13-19(20)9-21/h11-14,21-22H,7-10,15-16H2,1-6H3 |
| InChIKey | IMSQSEBESWFRIQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |