C16H24O5 — CID 139038707
[(1S,2S,4R,5S,7S,9S)-2-tert-butyl-3,6,8-trioxatetracyclo[5.5.1.01,9.04,9]tridecan-5-yl] acetate (PubChem CID 139038707) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is [(1S,2S,4R,5S,7S,9S)-2-tert-butyl-3,6,8-trioxatetracyclo[5.5.1.01,9.04,9]tridecan-5-yl] acetate.
| Compound Name | [(1S,2S,4R,5S,7S,9S)-2-tert-butyl-3,6,8-trioxatetracyclo[5.5.1.01,9.04,9]tridecan-5-yl] acetate |
|---|---|
| PubChem CID | 139038707 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | [(1S,2S,4R,5S,7S,9S)-2-tert-butyl-3,6,8-trioxatetracyclo[5.5.1.01,9.04,9]tridecan-5-yl] acetate |
| SMILES | CC(=O)O[C@@H]1O[C@H]2C[C@]34CCC[C@@]3(O2)[C@H]1O[C@H]4C(C)(C)C |
| InChI | InChI=1S/C16H24O5/c1-9(17)18-12-11-16-7-5-6-15(16,8-10(19-12)21-16)13(20-11)14(2,3)4/h10-13H,5-8H2,1-4H3/t10-,11+,12-,13+,15+,16-/m1/s1 |
| InChIKey | UVDQUZRLYKRYPC-BEKRQIFDSA-N |
| XLogP | 2.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |