C18H24O3S — CID 139039371
(3R,3aS,8aS)-3-(benzenesulfonylmethyl)-2-methylidene-1,3,4,5,6,7,8,8a-octahydroazulen-3a-ol (PubChem CID 139039371) has the molecular formula C18H24O3S and a molecular weight of 320.45 g/mol. Its IUPAC name is (3R,3aS,8aS)-3-(benzenesulfonylmethyl)-2-methylidene-1,3,4,5,6,7,8,8a-octahydroazulen-3a-ol.
| Compound Name | (3R,3aS,8aS)-3-(benzenesulfonylmethyl)-2-methylidene-1,3,4,5,6,7,8,8a-octahydroazulen-3a-ol |
|---|---|
| PubChem CID | 139039371 |
| Molecular Formula | C18H24O3S |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | (3R,3aS,8aS)-3-(benzenesulfonylmethyl)-2-methylidene-1,3,4,5,6,7,8,8a-octahydroazulen-3a-ol |
| SMILES | C=C1C[C@@H]2CCCCC[C@@]2(O)[C@@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H24O3S/c1-14-12-15-8-4-3-7-11-18(15,19)17(14)13-22(20,21)16-9-5-2-6-10-16/h2,5-6,9-10,15,17,19H,1,3-4,7-8,11-13H2/t15-,17+,18-/m0/s1 |
| InChIKey | NNPPOBFQAIAOBN-JQHSSLGASA-N |
| XLogP | 3.35 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|