C17H28O3S — CID 20563699
3,4-dimethyl-1-(4-methylphenyl)sulfonyloctan-3-ol (PubChem CID 20563699) has the molecular formula C17H28O3S and a molecular weight of 312.47 g/mol. Its IUPAC name is 3,4-dimethyl-1-(4-methylphenyl)sulfonyloctan-3-ol.
| Compound Name | 3,4-dimethyl-1-(4-methylphenyl)sulfonyloctan-3-ol |
|---|---|
| PubChem CID | 20563699 |
| Molecular Formula | C17H28O3S |
| Molecular Weight | 312.47 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 3,4-dimethyl-1-(4-methylphenyl)sulfonyloctan-3-ol |
| SMILES | CCCCC(C)C(C)(O)CCS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H28O3S/c1-5-6-7-15(3)17(4,18)12-13-21(19,20)16-10-8-14(2)9-11-16/h8-11,15,18H,5-7,12-13H2,1-4H3 |
| InChIKey | IONNQQGDLHINSQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |