C32H52O3S — CID 139401248
(3S)-3-[[(4S,5R)-4-[(1R,3S)-3-[(2R)-4-(benzenesulfonyl)butan-2-yl]cyclopentyl]-5-butylcyclohexen-1-yl]methyl]hexan-3-ol (PubChem CID 139401248) has the molecular formula C32H52O3S and a molecular weight of 516.83 g/mol. Its IUPAC name is (3S)-3-[[(4S,5R)-4-[(1R,3S)-3-[(2R)-4-(benzenesulfonyl)butan-2-yl]cyclopentyl]-5-butylcyclohexen-1-yl]methyl]hexan-3-ol.
| Compound Name | (3S)-3-[[(4S,5R)-4-[(1R,3S)-3-[(2R)-4-(benzenesulfonyl)butan-2-yl]cyclopentyl]-5-butylcyclohexen-1-yl]methyl]hexan-3-ol |
|---|---|
| PubChem CID | 139401248 |
| Molecular Formula | C32H52O3S |
| Molecular Weight | 516.83 g/mol |
| Exact Mass | 516.36 |
| IUPAC Name | (3S)-3-[[(4S,5R)-4-[(1R,3S)-3-[(2R)-4-(benzenesulfonyl)butan-2-yl]cyclopentyl]-5-butylcyclohexen-1-yl]methyl]hexan-3-ol |
| SMILES | CCCC[C@@H]1CC(C[C@](O)(CC)CCC)=CC[C@H]1[C@@H]1CC[C@H]([C@H](C)CCS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C32H52O3S/c1-5-8-12-28-22-26(24-32(33,7-3)20-6-2)15-18-31(28)29-17-16-27(23-29)25(4)19-21-36(34,35)30-13-10-9-11-14-30/h9-11,13-15,25,27-29,31,33H,5-8,12,16-24H2,1-4H3/t25-,27+,28-,29-,31-,32+/m1/s1 |
| InChIKey | QVMVRXOUPYVFCI-TYOLCQOJSA-N |
| XLogP | 8.38 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.83 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|