C16H17F3O2 — CID 139044958
(2S,3R)-2-(3,4-dihydro-2H-pyran-5-yl)-1,1,1-trifluoro-3-phenylpent-4-en-2-ol (PubChem CID 139044958) has the molecular formula C16H17F3O2 and a molecular weight of 298.30 g/mol. Its IUPAC name is (2S,3R)-2-(3,4-dihydro-2H-pyran-5-yl)-1,1,1-trifluoro-3-phenylpent-4-en-2-ol.
| Compound Name | (2S,3R)-2-(3,4-dihydro-2H-pyran-5-yl)-1,1,1-trifluoro-3-phenylpent-4-en-2-ol |
|---|---|
| PubChem CID | 139044958 |
| Molecular Formula | C16H17F3O2 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (2S,3R)-2-(3,4-dihydro-2H-pyran-5-yl)-1,1,1-trifluoro-3-phenylpent-4-en-2-ol |
| SMILES | C=C[C@H](c1ccccc1)[C@](O)(C1=COCCC1)C(F)(F)F |
| InChI | InChI=1S/C16H17F3O2/c1-2-14(12-7-4-3-5-8-12)15(20,16(17,18)19)13-9-6-10-21-11-13/h2-5,7-8,11,14,20H,1,6,9-10H2/t14-,15-/m1/s1 |
| InChIKey | KXWXHRRQLIHGGL-HUUCEWRRSA-N |
| XLogP | 3.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|