C36H26Br2N2O8 — CID 139052081
bis(4-[(E)-2-(4-bromophenyl)ethenyl]pyridin-1-ium);4,6-dicarboxybenzene-1,3-dicarboxylate (PubChem CID 139052081) has the molecular formula C36H26Br2N2O8 and a molecular weight of 774.42 g/mol. Its IUPAC name is bis(4-[(E)-2-(4-bromophenyl)ethenyl]pyridin-1-ium);4,6-dicarboxybenzene-1,3-dicarboxylate.
| Compound Name | bis(4-[(E)-2-(4-bromophenyl)ethenyl]pyridin-1-ium);4,6-dicarboxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 139052081 |
| Molecular Formula | C36H26Br2N2O8 |
| Molecular Weight | 774.42 g/mol |
| Exact Mass | 772.01 |
| IUPAC Name | bis(4-[(E)-2-(4-bromophenyl)ethenyl]pyridin-1-ium);4,6-dicarboxybenzene-1,3-dicarboxylate |
| SMILES | Brc1ccc(/C=C/c2cc[nH+]cc2)cc1.Brc1ccc(/C=C/c2cc[nH+]cc2)cc1.O=C([O-])c1cc(C(=O)[O-])c(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/2C13H10BrN.C10H6O8/c2*14-13-5-3-11(4-6-13)1-2-12-7-9-15-10-8-12;11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16/h2*1-10H;1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18)/b2*2-1+; |
| InChIKey | NEBUQEIRBYZOGQ-BUOKYLHBSA-N |
| XLogP | 4.68 |
| TPSA | 183.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |