C32H29BF2N2OS2 — CID 139052966
2,2-difluoro-8-(4-methoxyphenyl)-4,6,10,12-tetramethyl-5,11-bis(phenylsulfanyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 139052966) has the molecular formula C32H29BF2N2OS2 and a molecular weight of 570.54 g/mol. Its IUPAC name is 2,2-difluoro-8-(4-methoxyphenyl)-4,6,10,12-tetramethyl-5,11-bis(phenylsulfanyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-8-(4-methoxyphenyl)-4,6,10,12-tetramethyl-5,11-bis(phenylsulfanyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139052966 |
| Molecular Formula | C32H29BF2N2OS2 |
| Molecular Weight | 570.54 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | 2,2-difluoro-8-(4-methoxyphenyl)-4,6,10,12-tetramethyl-5,11-bis(phenylsulfanyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | COc1ccc(C2=C3C(C)=C(Sc4ccccc4)C(C)=[N+]3[B-](F)(F)n3c(C)c(Sc4ccccc4)c(C)c32)cc1 |
| InChI | InChI=1S/C32H29BF2N2OS2/c1-20-29-28(24-16-18-25(38-5)19-17-24)30-21(2)32(40-27-14-10-7-11-15-27)23(4)37(30)33(34,35)36(29)22(3)31(20)39-26-12-8-6-9-13-26/h6-19H,1-5H3 |
| InChIKey | QYXVFLPZJVSYNA-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 17.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.54 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|