C23H29NO10 — CID 139055418
[(2S,3S,4R,5S,6S)-6-[acetyl(benzyl)amino]-3,4,5-triacetyloxyoxan-2-yl]methyl acetate (PubChem CID 139055418) has the molecular formula C23H29NO10 and a molecular weight of 479.48 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6S)-6-[acetyl(benzyl)amino]-3,4,5-triacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4R,5S,6S)-6-[acetyl(benzyl)amino]-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139055418 |
| Molecular Formula | C23H29NO10 |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | [(2S,3S,4R,5S,6S)-6-[acetyl(benzyl)amino]-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](N(Cc2ccccc2)C(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H29NO10/c1-13(25)24(11-18-9-7-6-8-10-18)23-22(33-17(5)29)21(32-16(4)28)20(31-15(3)27)19(34-23)12-30-14(2)26/h6-10,19-23H,11-12H2,1-5H3/t19-,20-,21+,22-,23-/m0/s1 |
| InChIKey | UCVCGIOXJQCFIJ-HPAIXVDQSA-N |
| XLogP | 1.12 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|