C22H27NO9 — CID 139081329
[(2S,3R,3aR,7R,7aR)-2,3,3a-triacetyloxy-5-benzyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-7-yl] acetate (PubChem CID 139081329) has the molecular formula C22H27NO9 and a molecular weight of 449.46 g/mol. Its IUPAC name is [(2S,3R,3aR,7R,7aR)-2,3,3a-triacetyloxy-5-benzyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-7-yl] acetate.
| Compound Name | [(2S,3R,3aR,7R,7aR)-2,3,3a-triacetyloxy-5-benzyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-7-yl] acetate |
|---|---|
| PubChem CID | 139081329 |
| Molecular Formula | C22H27NO9 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | [(2S,3R,3aR,7R,7aR)-2,3,3a-triacetyloxy-5-benzyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-7-yl] acetate |
| SMILES | CC(=O)O[C@@H]1O[C@@H]2[C@H](OC(C)=O)CN(Cc3ccccc3)C[C@]2(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H27NO9/c1-13(24)28-18-11-23(10-17-8-6-5-7-9-17)12-22(32-16(4)27)19(18)31-21(30-15(3)26)20(22)29-14(2)25/h5-9,18-21H,10-12H2,1-4H3/t18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | VMWILMGPGSENPG-QMCAAQAGSA-N |
| XLogP | 0.96 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|