C30H51NO8 — CID 10792840
(1S,15R,16S,18R,19R)-8-benzyl-19-butoxy-18-(butoxymethyl)-16-methoxy-2,5,11,14,17-pentaoxa-8-azabicyclo[13.4.0]nonadecane (PubChem CID 10792840) has the molecular formula C30H51NO8 and a molecular weight of 553.74 g/mol. Its IUPAC name is (1S,15R,16S,18R,19R)-8-benzyl-19-butoxy-18-(butoxymethyl)-16-methoxy-2,5,11,14,17-pentaoxa-8-azabicyclo[13.4.0]nonadecane.
| Compound Name | (1S,15R,16S,18R,19R)-8-benzyl-19-butoxy-18-(butoxymethyl)-16-methoxy-2,5,11,14,17-pentaoxa-8-azabicyclo[13.4.0]nonadecane |
|---|---|
| PubChem CID | 10792840 |
| Molecular Formula | C30H51NO8 |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.36 |
| IUPAC Name | (1S,15R,16S,18R,19R)-8-benzyl-19-butoxy-18-(butoxymethyl)-16-methoxy-2,5,11,14,17-pentaoxa-8-azabicyclo[13.4.0]nonadecane |
| SMILES | CCCCOC[C@H]1O[C@H](OC)[C@@H]2OCCOCCN(Cc3ccccc3)CCOCCO[C@H]2[C@@H]1OCCCC |
| InChI | InChI=1S/C30H51NO8/c1-4-6-15-35-24-26-27(36-16-7-5-2)28-29(30(32-3)39-26)38-22-20-34-18-14-31(13-17-33-19-21-37-28)23-25-11-9-8-10-12-25/h8-12,26-30H,4-7,13-24H2,1-3H3/t26-,27-,28+,29-,30+/m1/s1 |
| InChIKey | KOWCWGPRJNDZFV-RLXMVLCYSA-N |
| XLogP | 3.68 |
| TPSA | 77.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|