C19H22O2S2 — CID 139057999
(1S,2S)-2-[(2S)-oxan-2-yl]sulfanyl-1-phenyl-2-phenylsulfanylethanol (PubChem CID 139057999) has the molecular formula C19H22O2S2 and a molecular weight of 346.52 g/mol. Its IUPAC name is (1S,2S)-2-[(2S)-oxan-2-yl]sulfanyl-1-phenyl-2-phenylsulfanylethanol.
| Compound Name | (1S,2S)-2-[(2S)-oxan-2-yl]sulfanyl-1-phenyl-2-phenylsulfanylethanol |
|---|---|
| PubChem CID | 139057999 |
| Molecular Formula | C19H22O2S2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (1S,2S)-2-[(2S)-oxan-2-yl]sulfanyl-1-phenyl-2-phenylsulfanylethanol |
| SMILES | O[C@@H](c1ccccc1)[C@@H](Sc1ccccc1)S[C@H]1CCCCO1 |
| InChI | InChI=1S/C19H22O2S2/c20-18(15-9-3-1-4-10-15)19(22-16-11-5-2-6-12-16)23-17-13-7-8-14-21-17/h1-6,9-12,17-20H,7-8,13-14H2/t17-,18-,19-/m0/s1 |
| InChIKey | AXDNOGZPRARZCB-FHWLQOOXSA-N |
| XLogP | 5.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|