C26H30N2O2S4 — CID 139058221
(6R)-6-benzyl-3,3-dimethylmorpholine-2,5-dithione (PubChem CID 139058221) has the molecular formula C26H30N2O2S4 and a molecular weight of 530.81 g/mol. Its IUPAC name is (6R)-6-benzyl-3,3-dimethylmorpholine-2,5-dithione.
| Compound Name | (6R)-6-benzyl-3,3-dimethylmorpholine-2,5-dithione |
|---|---|
| PubChem CID | 139058221 |
| Molecular Formula | C26H30N2O2S4 |
| Molecular Weight | 530.81 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | (6R)-6-benzyl-3,3-dimethylmorpholine-2,5-dithione |
| SMILES | CC1(C)NC(=S)[C@@H](Cc2ccccc2)OC1=S.CC1(C)NC(=S)[C@@H](Cc2ccccc2)OC1=S |
| InChI | InChI=1S/2C13H15NOS2/c2*1-13(2)12(17)15-10(11(16)14-13)8-9-6-4-3-5-7-9/h2*3-7,10H,8H2,1-2H3,(H,14,16)/t2*10-/m11/s1 |
| InChIKey | RTNIJYWHBJXJKM-IMUCLEIGSA-N |
| XLogP | 5.30 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.81 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|