C30H22N4O8 — CID 139063403
4,6-dicarboxybenzene-1,3-dicarboxylate;bis(4-pyridin-1-ium-4-ylpyridine) (PubChem CID 139063403) has the molecular formula C30H22N4O8 and a molecular weight of 566.53 g/mol. Its IUPAC name is 4,6-dicarboxybenzene-1,3-dicarboxylate;bis(4-pyridin-1-ium-4-ylpyridine).
| Compound Name | 4,6-dicarboxybenzene-1,3-dicarboxylate;bis(4-pyridin-1-ium-4-ylpyridine) |
|---|---|
| PubChem CID | 139063403 |
| Molecular Formula | C30H22N4O8 |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | 4,6-dicarboxybenzene-1,3-dicarboxylate;bis(4-pyridin-1-ium-4-ylpyridine) |
| SMILES | O=C([O-])c1cc(C(=O)[O-])c(C(=O)O)cc1C(=O)O.c1cc(-c2cc[nH+]cc2)ccn1.c1cc(-c2cc[nH+]cc2)ccn1 |
| InChI | InChI=1S/2C10H8N2.C10H6O8/c2*1-5-11-6-2-9(1)10-3-7-12-8-4-10;11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16/h2*1-8H;1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | OUSZKVQUHJBQRE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 208.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |