C14H21NO5S2 — CID 139064856
N-(4,4-dimethoxy-1-oxothian-1-ylidene)-4-methylbenzenesulfonamide (PubChem CID 139064856) has the molecular formula C14H21NO5S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-(4,4-dimethoxy-1-oxothian-1-ylidene)-4-methylbenzenesulfonamide.
| Compound Name | N-(4,4-dimethoxy-1-oxothian-1-ylidene)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 139064856 |
| Molecular Formula | C14H21NO5S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-(4,4-dimethoxy-1-oxothian-1-ylidene)-4-methylbenzenesulfonamide |
| SMILES | COC1(OC)CCS(=O)(=NS(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C14H21NO5S2/c1-12-4-6-13(7-5-12)22(17,18)15-21(16)10-8-14(19-2,20-3)9-11-21/h4-7H,8-11H2,1-3H3 |
| InChIKey | UAJOZVWLYXQKGF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|