About 2-bromo-6-(3-methylimidazol-3-ium-1-yl)pyridine;bromide;hydrate
2-bromo-6-(3-methylimidazol-3-ium-1-yl)pyridine;bromide;hydrate (PubChem CID 139067364) has the molecular formula C9H11Br2N3O
and a molecular weight of 337.02 g/mol. Its IUPAC name is 2-bromo-6-(3-methylimidazol-3-ium-1-yl)pyridine;bromide;hydrate.
Molecular Properties
| Compound Name | 2-bromo-6-(3-methylimidazol-3-ium-1-yl)pyridine;bromide;hydrate |
| PubChem CID | 139067364 |
| Molecular Formula | C9H11Br2N3O |
| Molecular Weight | 337.02 g/mol |
| Exact Mass | 334.93 |
| IUPAC Name | 2-bromo-6-(3-methylimidazol-3-ium-1-yl)pyridine;bromide;hydrate |
| SMILES | C[n+]1ccn(-c2cccc(Br)n2)c1.O.[Br-] |
| InChI | InChI=1S/C9H9BrN3.BrH.H2O/c1-12-5-6-13(7-12)9-4-2-3-8(10)11-9;;/h2-7H,1H3;1H;1H2/q+1;;/p-1 |
| InChIKey | JIPMLHVQOLBLEX-UHFFFAOYSA-M |
| XLogP | -2.36 |
| TPSA | 53.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.02 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-(3-methylimidazol-3-ium-1-yl)pyridine;bromide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-(3-methylimidazol-3-ium-1-yl)pyridine;bromide;hydrate?
The IUPAC name of 2-bromo-6-(3-methylimidazol-3-ium-1-yl)pyridine;bromide;hydrate (CID 139067364) is 2-bromo-6-(3-methylimidazol-3-ium-1-yl)pyridine;bromide;hydrate.
What is the SMILES notation for 2-bromo-6-(3-methylimidazol-3-ium-1-yl)pyridine;bromide;hydrate?
The canonical SMILES for 2-bromo-6-(3-methylimidazol-3-ium-1-yl)pyridine;bromide;hydrate is C[n+]1ccn(-c2cccc(Br)n2)c1.O.[Br-].
What is the InChIKey of 2-bromo-6-(3-methylimidazol-3-ium-1-yl)pyridine;bromide;hydrate?
The InChIKey is JIPMLHVQOLBLEX-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H9BrN3.BrH.H2O/c1-12-5-6-13(7-12)9-4-2-3-8(10)11-9;;/h2-7H,1H3;1H;1H2/q+1;;/p-1.
What are the key properties of 2-bromo-6-(3-methylimidazol-3-ium-1-yl)pyridine;bromide;hydrate?
2-bromo-6-(3-methylimidazol-3-ium-1-yl)pyridine;bromide;hydrate has a molecular weight of 337.02 g/mol, XLogP of -2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-(3-methylimidazol-3-ium-1-yl)pyridine;bromide;hydrate is sourced from PubChem (CID 139067364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).