C26H18CuN2O6 — CID 139067421
copper;bis(4-hydroxybenzoate);1,10-phenanthroline (PubChem CID 139067421) has the molecular formula C26H18CuN2O6 and a molecular weight of 517.98 g/mol. Its IUPAC name is copper;bis(4-hydroxybenzoate);1,10-phenanthroline.
| Compound Name | copper;bis(4-hydroxybenzoate);1,10-phenanthroline |
|---|---|
| PubChem CID | 139067421 |
| Molecular Formula | C26H18CuN2O6 |
| Molecular Weight | 517.98 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | copper;bis(4-hydroxybenzoate);1,10-phenanthroline |
| SMILES | O=C([O-])c1ccc(O)cc1.O=C([O-])c1ccc(O)cc1.[Cu+2].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.2C7H6O3.Cu/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;2*8-6-3-1-5(2-4-6)7(9)10;/h1-8H;2*1-4,8H,(H,9,10);/q;;;+2/p-2 |
| InChIKey | FBZOMLMDDRNLDW-UHFFFAOYSA-L |
| XLogP | 2.29 |
| TPSA | 146.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.98 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|