C52H50N8O2S — CID 139067920
(PubChem CID 139067920) has the molecular formula C52H50N8O2S and a molecular weight of 851.09 g/mol.
| Compound Name | |
|---|---|
| PubChem CID | 139067920 |
| Molecular Formula | C52H50N8O2S |
| Molecular Weight | 851.09 g/mol |
| Exact Mass | 850.38 |
| IUPAC Name | — |
| SMILES | CC#N.CC#N.CN(C)c1ccc([C@@H]2CN(C)[C@]3(C(=O)Nc4ccccc43)[C@]23SC2=NC4=C(CN(Cc5ccccc5)C/C4=C\c4ccccc4)[C@H](c4ccccc4)N2C3=O)cc1 |
| InChI | InChI=1S/C48H44N6O2S.2C2H3N/c1-51(2)37-25-23-34(24-26-37)40-31-52(3)47(39-21-13-14-22-41(39)49-44(47)55)48(40)45(56)54-43(35-19-11-6-12-20-35)38-30-53(28-33-17-9-5-10-18-33)29-36(42(38)50-46(54)57-48)27-32-15-7-4-8-16-32;2*1-2-3/h4-27,40,43H,28-31H2,1-3H3,(H,49,55);2*1H3/b36-27+;;/t40-,43-,47+,48-;;/m0../s1 |
| InChIKey | KUVTVFIVKPBXPY-UUPMNINASA-N |
| XLogP | 8.97 |
| TPSA | 119.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.09 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|