About Disodium Rhodizonate
Disodium Rhodizonate (PubChem CID 139068412) has the molecular formula C6Na2O6
and a molecular weight of 214.04 g/mol.
Molecular Properties
| Compound Name | Disodium Rhodizonate |
| PubChem CID | 139068412 |
| Molecular Formula | C6Na2O6 |
| Molecular Weight | 214.04 g/mol |
| Exact Mass | 213.95 |
| IUPAC Name | — |
| SMILES | O=C1C(=O)C(=O)C(=O)C(=O)C1=O.[Na].[Na] |
| InChI | InChI=1S/C6O6.2Na/c7-1-2(8)4(10)6(12)5(11)3(1)9;; |
| InChIKey | SIVSOQRTHDYSMP-UHFFFAOYSA-N |
| XLogP | -3.35 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.04 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze Disodium Rhodizonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Disodium Rhodizonate?
The IUPAC name of Disodium Rhodizonate (CID 139068412) is not available.
What is the SMILES notation for Disodium Rhodizonate?
The canonical SMILES for Disodium Rhodizonate is O=C1C(=O)C(=O)C(=O)C(=O)C1=O.[Na].[Na].
What is the InChIKey of Disodium Rhodizonate?
The InChIKey is SIVSOQRTHDYSMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6O6.2Na/c7-1-2(8)4(10)6(12)5(11)3(1)9;;.
What are the key properties of Disodium Rhodizonate?
Disodium Rhodizonate has a molecular weight of 214.04 g/mol, XLogP of -3.35, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Disodium Rhodizonate is sourced from PubChem (CID 139068412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).